C22H20N2O2 — CID 16731239
2-[3-(3-methoxyphenyl)phenyl]-2-methyl-1,3-benzoxazin-4-amine (PubChem CID 16731239) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)phenyl]-2-methyl-1,3-benzoxazin-4-amine.
| Compound Name | 2-[3-(3-methoxyphenyl)phenyl]-2-methyl-1,3-benzoxazin-4-amine |
|---|---|
| PubChem CID | 16731239 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)phenyl]-2-methyl-1,3-benzoxazin-4-amine |
| SMILES | COc1cccc(-c2cccc(C3(C)N=C(N)c4ccccc4O3)c2)c1 |
| InChI | InChI=1S/C22H20N2O2/c1-22(24-21(23)19-11-3-4-12-20(19)26-22)17-9-5-7-15(13-17)16-8-6-10-18(14-16)25-2/h3-14H,1-2H3,(H2,23,24) |
| InChIKey | RHBKGFVBSYKCMN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |