C20H15Cl2N3O — CID 59596261
3-(2,6-dichloro-4-pyridinyl)-3-(3-methoxyphenyl)isoindol-1-amine (PubChem CID 59596261) has the molecular formula C20H15Cl2N3O and a molecular weight of 384.27 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-pyridinyl)-3-(3-methoxyphenyl)isoindol-1-amine.
| Compound Name | 3-(2,6-dichloro-4-pyridinyl)-3-(3-methoxyphenyl)isoindol-1-amine |
|---|---|
| PubChem CID | 59596261 |
| Molecular Formula | C20H15Cl2N3O |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 3-(2,6-dichloro-4-pyridinyl)-3-(3-methoxyphenyl)isoindol-1-amine |
| SMILES | COc1cccc(C2(c3cc(Cl)nc(Cl)c3)N=C(N)c3ccccc32)c1 |
| InChI | InChI=1S/C20H15Cl2N3O/c1-26-14-6-4-5-12(9-14)20(13-10-17(21)24-18(22)11-13)16-8-3-2-7-15(16)19(23)25-20/h2-11H,1H3,(H2,23,25) |
| InChIKey | PCTKIBMOPCIFCG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|