C22H19BrN2O — CID 59596275
3-(3-bromophenyl)-3-(4-methoxy-3-methylphenyl)isoindol-1-amine (PubChem CID 59596275) has the molecular formula C22H19BrN2O and a molecular weight of 407.31 g/mol. Its IUPAC name is 3-(3-bromophenyl)-3-(4-methoxy-3-methylphenyl)isoindol-1-amine.
| Compound Name | 3-(3-bromophenyl)-3-(4-methoxy-3-methylphenyl)isoindol-1-amine |
|---|---|
| PubChem CID | 59596275 |
| Molecular Formula | C22H19BrN2O |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-(3-bromophenyl)-3-(4-methoxy-3-methylphenyl)isoindol-1-amine |
| SMILES | COc1ccc(C2(c3cccc(Br)c3)N=C(N)c3ccccc32)cc1C |
| InChI | InChI=1S/C22H19BrN2O/c1-14-12-16(10-11-20(14)26-2)22(15-6-5-7-17(23)13-15)19-9-4-3-8-18(19)21(24)25-22/h3-13H,1-2H3,(H2,24,25) |
| InChIKey | VACQPXAJOPDJJH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |