C21H16BrFN2O — CID 58579518
3-(3-bromophenyl)-7-fluoro-3-(4-methoxyphenyl)isoindol-1-amine (PubChem CID 58579518) has the molecular formula C21H16BrFN2O and a molecular weight of 411.27 g/mol. Its IUPAC name is 3-(3-bromophenyl)-7-fluoro-3-(4-methoxyphenyl)isoindol-1-amine.
| Compound Name | 3-(3-bromophenyl)-7-fluoro-3-(4-methoxyphenyl)isoindol-1-amine |
|---|---|
| PubChem CID | 58579518 |
| Molecular Formula | C21H16BrFN2O |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-(3-bromophenyl)-7-fluoro-3-(4-methoxyphenyl)isoindol-1-amine |
| SMILES | COc1ccc(C2(c3cccc(Br)c3)N=C(N)c3c(F)cccc32)cc1 |
| InChI | InChI=1S/C21H16BrFN2O/c1-26-16-10-8-13(9-11-16)21(14-4-2-5-15(22)12-14)17-6-3-7-18(23)19(17)20(24)25-21/h2-12H,1H3,(H2,24,25) |
| InChIKey | KXTWUNJCHNJYIP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |