C26H18FN5O — CID 46202742
5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxybenzonitrile (PubChem CID 46202742) has the molecular formula C26H18FN5O and a molecular weight of 435.46 g/mol. Its IUPAC name is 5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxybenzonitrile.
| Compound Name | 5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 46202742 |
| Molecular Formula | C26H18FN5O |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(C2(c3cccc(-c4cncnc4)c3)N=C(N)c3c(F)cccc32)cc1C#N |
| InChI | InChI=1S/C26H18FN5O/c1-33-23-9-8-20(11-17(23)12-28)26(21-6-3-7-22(27)24(21)25(29)32-26)19-5-2-4-16(10-19)18-13-30-15-31-14-18/h2-11,13-15H,1H3,(H2,29,32) |
| InChIKey | JOAINBRZFKXAKE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |