C26H19F2N3O — CID 46206293
7-fluoro-3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-pyridin-4-ylisoindol-1-amine (PubChem CID 46206293) has the molecular formula C26H19F2N3O and a molecular weight of 427.45 g/mol. Its IUPAC name is 7-fluoro-3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-pyridin-4-ylisoindol-1-amine.
| Compound Name | 7-fluoro-3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-pyridin-4-ylisoindol-1-amine |
|---|---|
| PubChem CID | 46206293 |
| Molecular Formula | C26H19F2N3O |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 7-fluoro-3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-pyridin-4-ylisoindol-1-amine |
| SMILES | COc1cccc(-c2cccc(C3(c4ccncc4)N=C(N)c4c(F)cccc43)c2)c1F |
| InChI | InChI=1S/C26H19F2N3O/c1-32-22-10-3-7-19(24(22)28)16-5-2-6-18(15-16)26(17-11-13-30-14-12-17)20-8-4-9-21(27)23(20)25(29)31-26/h2-15H,1H3,(H2,29,31) |
| InChIKey | XZSIDTPFYUFTSR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |