C26H23N5 — CID 24874780
3-(2-propan-2-yl-4-pyridinyl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine (PubChem CID 24874780) has the molecular formula C26H23N5 and a molecular weight of 405.51 g/mol. Its IUPAC name is 3-(2-propan-2-yl-4-pyridinyl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine.
| Compound Name | 3-(2-propan-2-yl-4-pyridinyl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine |
|---|---|
| PubChem CID | 24874780 |
| Molecular Formula | C26H23N5 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 3-(2-propan-2-yl-4-pyridinyl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine |
| SMILES | CC(C)c1cc(C2(c3cccc(-c4cncnc4)c3)N=C(N)c3ccccc32)ccn1 |
| InChI | InChI=1S/C26H23N5/c1-17(2)24-13-21(10-11-30-24)26(23-9-4-3-8-22(23)25(27)31-26)20-7-5-6-18(12-20)19-14-28-16-29-15-19/h3-17H,1-2H3,(H2,27,31) |
| InChIKey | BSJUWHOXOHIPGJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |