C17H18N2OS — CID 71680849
2-[3-(3-methoxyphenyl)phenyl]-2-methyl-5H-1,3-thiazol-4-amine (PubChem CID 71680849) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)phenyl]-2-methyl-5H-1,3-thiazol-4-amine.
| Compound Name | 2-[3-(3-methoxyphenyl)phenyl]-2-methyl-5H-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 71680849 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)phenyl]-2-methyl-5H-1,3-thiazol-4-amine |
| SMILES | COc1cccc(-c2cccc(C3(C)N=C(N)CS3)c2)c1 |
| InChI | InChI=1S/C17H18N2OS/c1-17(19-16(18)11-21-17)14-7-3-5-12(9-14)13-6-4-8-15(10-13)20-2/h3-10H,11H2,1-2H3,(H2,18,19) |
| InChIKey | HQOFZPLMGHLAJL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |