C25H24F3N3O2S — CID 143463779
2-amino-5-[3-(3-methoxyphenyl)phenyl]-3-methyl-5-(4-methylphenyl)imidazol-4-one;trifluoromethanethiol (PubChem CID 143463779) has the molecular formula C25H24F3N3O2S and a molecular weight of 487.55 g/mol. Its IUPAC name is 2-amino-5-[3-(3-methoxyphenyl)phenyl]-3-methyl-5-(4-methylphenyl)imidazol-4-one;trifluoromethanethiol.
| Compound Name | 2-amino-5-[3-(3-methoxyphenyl)phenyl]-3-methyl-5-(4-methylphenyl)imidazol-4-one;trifluoromethanethiol |
|---|---|
| PubChem CID | 143463779 |
| Molecular Formula | C25H24F3N3O2S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-amino-5-[3-(3-methoxyphenyl)phenyl]-3-methyl-5-(4-methylphenyl)imidazol-4-one;trifluoromethanethiol |
| SMILES | COc1cccc(-c2cccc(C3(c4ccc(C)cc4)N=C(N)N(C)C3=O)c2)c1.FC(F)(F)S |
| InChI | InChI=1S/C24H23N3O2.CHF3S/c1-16-10-12-19(13-11-16)24(22(28)27(2)23(25)26-24)20-8-4-6-17(14-20)18-7-5-9-21(15-18)29-3;2-1(3,4)5/h4-15H,1-3H3,(H2,25,26);5H |
| InChIKey | QQVFIWQWDHKNMY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|