C23H21N3O3 — CID 16750245
2-amino-5-[3-(2-hydroxy-5-methoxyphenyl)phenyl]-3-methyl-5-phenylimidazol-4-one (PubChem CID 16750245) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-amino-5-[3-(2-hydroxy-5-methoxyphenyl)phenyl]-3-methyl-5-phenylimidazol-4-one.
| Compound Name | 2-amino-5-[3-(2-hydroxy-5-methoxyphenyl)phenyl]-3-methyl-5-phenylimidazol-4-one |
|---|---|
| PubChem CID | 16750245 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-amino-5-[3-(2-hydroxy-5-methoxyphenyl)phenyl]-3-methyl-5-phenylimidazol-4-one |
| SMILES | COc1ccc(O)c(-c2cccc(C3(c4ccccc4)N=C(N)N(C)C3=O)c2)c1 |
| InChI | InChI=1S/C23H21N3O3/c1-26-21(28)23(25-22(26)24,16-8-4-3-5-9-16)17-10-6-7-15(13-17)19-14-18(29-2)11-12-20(19)27/h3-14,27H,1-2H3,(H2,24,25) |
| InChIKey | ZJRWOHCJRPHTTN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |