C25H21F3N3O6S- — CID 152762993
[3-[3-[2-amino-1-methyl-5-oxo-4-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]phenyl]-5-methoxyphenyl]methanesulfonate (PubChem CID 152762993) has the molecular formula C25H21F3N3O6S- and a molecular weight of 548.52 g/mol. Its IUPAC name is [3-[3-[2-amino-1-methyl-5-oxo-4-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]phenyl]-5-methoxyphenyl]methanesulfonate.
| Compound Name | [3-[3-[2-amino-1-methyl-5-oxo-4-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]phenyl]-5-methoxyphenyl]methanesulfonate |
|---|---|
| PubChem CID | 152762993 |
| Molecular Formula | C25H21F3N3O6S- |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | [3-[3-[2-amino-1-methyl-5-oxo-4-[4-(trifluoromethoxy)phenyl]imidazol-4-yl]phenyl]-5-methoxyphenyl]methanesulfonate |
| SMILES | COc1cc(CS(=O)(=O)[O-])cc(-c2cccc(C3(c4ccc(OC(F)(F)F)cc4)N=C(N)N(C)C3=O)c2)c1 |
| InChI | InChI=1S/C25H22F3N3O6S/c1-31-22(32)24(30-23(31)29,18-6-8-20(9-7-18)37-25(26,27)28)19-5-3-4-16(12-19)17-10-15(14-38(33,34)35)11-21(13-17)36-2/h3-13H,14H2,1-2H3,(H2,29,30)(H,33,34,35)/p-1 |
| InChIKey | DYHSFHISILFMQT-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|