C27H29N3O7S2 — CID 143463786
[3-[3-[2-amino-1-methyl-5-oxo-4-(4-propylsulfinyloxyphenyl)imidazol-4-yl]phenyl]-5-methoxyphenyl] methanesulfonate (PubChem CID 143463786) has the molecular formula C27H29N3O7S2 and a molecular weight of 571.68 g/mol. Its IUPAC name is [3-[3-[2-amino-1-methyl-5-oxo-4-(4-propylsulfinyloxyphenyl)imidazol-4-yl]phenyl]-5-methoxyphenyl] methanesulfonate.
| Compound Name | [3-[3-[2-amino-1-methyl-5-oxo-4-(4-propylsulfinyloxyphenyl)imidazol-4-yl]phenyl]-5-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 143463786 |
| Molecular Formula | C27H29N3O7S2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | [3-[3-[2-amino-1-methyl-5-oxo-4-(4-propylsulfinyloxyphenyl)imidazol-4-yl]phenyl]-5-methoxyphenyl] methanesulfonate |
| SMILES | CCCS(=O)Oc1ccc(C2(c3cccc(-c4cc(OC)cc(OS(C)(=O)=O)c4)c3)N=C(N)N(C)C2=O)cc1 |
| InChI | InChI=1S/C27H29N3O7S2/c1-5-13-38(32)36-22-11-9-20(10-12-22)27(25(31)30(2)26(28)29-27)21-8-6-7-18(14-21)19-15-23(35-3)17-24(16-19)37-39(4,33)34/h6-12,14-17H,5,13H2,1-4H3,(H2,28,29) |
| InChIKey | ZOIMBZDNYIKAOE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|