C22H20N4O4S — CID 87682940
[4-[(4S)-2-amino-1-methyl-5-oxo-4-(3-pyridin-3-ylphenyl)imidazol-4-yl]phenyl] methanesulfonate (PubChem CID 87682940) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is [4-[(4S)-2-amino-1-methyl-5-oxo-4-(3-pyridin-3-ylphenyl)imidazol-4-yl]phenyl] methanesulfonate.
| Compound Name | [4-[(4S)-2-amino-1-methyl-5-oxo-4-(3-pyridin-3-ylphenyl)imidazol-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87682940 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | [4-[(4S)-2-amino-1-methyl-5-oxo-4-(3-pyridin-3-ylphenyl)imidazol-4-yl]phenyl] methanesulfonate |
| SMILES | CN1C(=O)[C@](c2ccc(OS(C)(=O)=O)cc2)(c2cccc(-c3cccnc3)c2)N=C1N |
| InChI | InChI=1S/C22H20N4O4S/c1-26-20(27)22(25-21(26)23,17-8-10-19(11-9-17)30-31(2,28)29)18-7-3-5-15(13-18)16-6-4-12-24-14-16/h3-14H,1-2H3,(H2,23,25)/t22-/m0/s1 |
| InChIKey | MSPPVHDIOMSIMH-QFIPXVFZSA-N |
| XLogP | 2.12 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|