C21H16F3N3O2S — CID 59386861
2-amino-3-methyl-5-phenyl-5-[4-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]imidazol-4-one (PubChem CID 59386861) has the molecular formula C21H16F3N3O2S and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-amino-3-methyl-5-phenyl-5-[4-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]imidazol-4-one.
| Compound Name | 2-amino-3-methyl-5-phenyl-5-[4-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]imidazol-4-one |
|---|---|
| PubChem CID | 59386861 |
| Molecular Formula | C21H16F3N3O2S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-amino-3-methyl-5-phenyl-5-[4-[3-(trifluoromethoxy)phenyl]thiophen-2-yl]imidazol-4-one |
| SMILES | CN1C(=O)C(c2ccccc2)(c2cc(-c3cccc(OC(F)(F)F)c3)cs2)N=C1N |
| InChI | InChI=1S/C21H16F3N3O2S/c1-27-18(28)20(26-19(27)25,15-7-3-2-4-8-15)17-11-14(12-30-17)13-6-5-9-16(10-13)29-21(22,23)24/h2-12H,1H3,(H2,25,26) |
| InChIKey | BROCRLOJQHHZRN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |