C20H16FN3OS — CID 59388755
2-amino-5-[5-(3-fluorophenyl)thiophen-2-yl]-3-methyl-5-phenylimidazol-4-one (PubChem CID 59388755) has the molecular formula C20H16FN3OS and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-amino-5-[5-(3-fluorophenyl)thiophen-2-yl]-3-methyl-5-phenylimidazol-4-one.
| Compound Name | 2-amino-5-[5-(3-fluorophenyl)thiophen-2-yl]-3-methyl-5-phenylimidazol-4-one |
|---|---|
| PubChem CID | 59388755 |
| Molecular Formula | C20H16FN3OS |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-amino-5-[5-(3-fluorophenyl)thiophen-2-yl]-3-methyl-5-phenylimidazol-4-one |
| SMILES | CN1C(=O)C(c2ccccc2)(c2ccc(-c3cccc(F)c3)s2)N=C1N |
| InChI | InChI=1S/C20H16FN3OS/c1-24-18(25)20(23-19(24)22,14-7-3-2-4-8-14)17-11-10-16(26-17)13-6-5-9-15(21)12-13/h2-12H,1H3,(H2,22,23) |
| InChIKey | LBGICMZACFJNPI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |