About quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate
quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate (PubChem CID 47081979) has the molecular formula C20H16FNO2
and a molecular weight of 321.35 g/mol. Its IUPAC name is quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
| PubChem CID | 47081979 |
| Molecular Formula | C20H16FNO2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
| SMILES | O=C(Oc1ccc2ncccc2c1)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C20H16FNO2/c21-16-6-4-15(5-7-16)20(10-2-11-20)19(23)24-17-8-9-18-14(13-17)3-1-12-22-18/h1,3-9,12-13H,2,10-11H2 |
| InChIKey | MUEMNZIMSXYETC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate?
The IUPAC name of quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate (CID 47081979) is quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate.
What is the SMILES notation for quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate?
The canonical SMILES for quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate is O=C(Oc1ccc2ncccc2c1)C1(c2ccc(F)cc2)CCC1.
What is the InChIKey of quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate?
The InChIKey is MUEMNZIMSXYETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FNO2/c21-16-6-4-15(5-7-16)20(10-2-11-20)19(23)24-17-8-9-18-14(13-17)3-1-12-22-18/h1,3-9,12-13H,2,10-11H2.
What are the key properties of quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate?
quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate has a molecular weight of 321.35 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-6-yl 1-(4-fluorophenyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 47081979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).