C16H24N6O5S — CID 91948089
N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 91948089) has the molecular formula C16H24N6O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91948089 |
| Molecular Formula | C16H24N6O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | Cn1c(=O)c2[nH]c(CCCNC(=O)C3CCCN3S(C)(=O)=O)nc2n(C)c1=O |
| InChI | InChI=1S/C16H24N6O5S/c1-20-13-12(15(24)21(2)16(20)25)18-11(19-13)7-4-8-17-14(23)10-6-5-9-22(10)28(3,26)27/h10H,4-9H2,1-3H3,(H,17,23)(H,18,19) |
| InChIKey | VFLBTBTVEWAQMN-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|