C14H24N2O3S — CID 110753679
N-[2-(cyclohexen-1-yl)ethyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 110753679) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110753679 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H24N2O3S/c1-20(18,19)16-11-5-8-13(16)14(17)15-10-9-12-6-3-2-4-7-12/h6,13H,2-5,7-11H2,1H3,(H,15,17) |
| InChIKey | JMKSYAYHLSZIGB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|