C21H29N3O2 — CID 644827
2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 644827) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 644827 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCCC2C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N3O2/c1-16-9-11-18(12-10-16)23-21(26)24-15-5-8-19(24)20(25)22-14-13-17-6-3-2-4-7-17/h6,9-12,19H,2-5,7-8,13-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | CTORSSJQZNSUNI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|