C24H35N3O2 — CID 95093805
(3R)-3-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]-N-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 95093805) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (3R)-3-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]-N-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]-N-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95093805 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (3R)-3-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]-N-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC[C@H](CCC(=O)NCCC3=CCCCC3)C2)cc1 |
| InChI | InChI=1S/C24H35N3O2/c1-19-9-12-22(13-10-19)26-24(29)27-17-5-8-21(18-27)11-14-23(28)25-16-15-20-6-3-2-4-7-20/h6,9-10,12-13,21H,2-5,7-8,11,14-18H2,1H3,(H,25,28)(H,26,29)/t21-/m1/s1 |
| InChIKey | UQIMYUPRIKDQPZ-OAQYLSRUSA-N |
| XLogP | 5.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|