C20H27ClN2O3S — CID 92887732
(2S)-1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-2-carboxamide (PubChem CID 92887732) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 92887732 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)[C@@H]1CCCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClN2O3S/c21-17-9-11-18(12-10-17)27(25,26)23-15-5-4-8-19(23)20(24)22-14-13-16-6-2-1-3-7-16/h6,9-12,19H,1-5,7-8,13-15H2,(H,22,24)/t19-/m0/s1 |
| InChIKey | AFCPZPOIKJCYLT-IBGZPJMESA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|