C20H24N6O3 — CID 41032215
(3R)-N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)piperidine-3-carboxamide (PubChem CID 41032215) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (3R)-N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 41032215 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (3R)-N-benzyl-1-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)piperidine-3-carboxamide |
| SMILES | Cn1c(=O)c2[nH]c(N3CCC[C@@H](C(=O)NCc4ccccc4)C3)nc2n(C)c1=O |
| InChI | InChI=1S/C20H24N6O3/c1-24-16-15(18(28)25(2)20(24)29)22-19(23-16)26-10-6-9-14(12-26)17(27)21-11-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12H2,1-2H3,(H,21,27)(H,22,23)/t14-/m1/s1 |
| InChIKey | HVJNPTDMKCEWSA-CQSZACIVSA-N |
| XLogP | 0.49 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |