C20H21N3O2 — CID 3622789
1-(1,3-benzoxazol-2-yl)-N-benzylpiperidine-3-carboxamide (PubChem CID 3622789) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-benzylpiperidine-3-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-benzylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3622789 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-benzylpiperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCCN(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C20H21N3O2/c24-19(21-13-15-7-2-1-3-8-15)16-9-6-12-23(14-16)20-22-17-10-4-5-11-18(17)25-20/h1-5,7-8,10-11,16H,6,9,12-14H2,(H,21,24) |
| InChIKey | JSTPUCQUHCDDFZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |