C18H25N3O3 — CID 3654131
1-(1,3-benzoxazol-2-yl)-N-(3-ethoxypropyl)piperidine-3-carboxamide (PubChem CID 3654131) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-(3-ethoxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-(3-ethoxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3654131 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-(3-ethoxypropyl)piperidine-3-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCCN(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C18H25N3O3/c1-2-23-12-6-10-19-17(22)14-7-5-11-21(13-14)18-20-15-8-3-4-9-16(15)24-18/h3-4,8-9,14H,2,5-7,10-13H2,1H3,(H,19,22) |
| InChIKey | NRJMGQACFJSKOU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|