C16H24N6O2 — CID 92889475
(3S)-N-(3-ethoxypropyl)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carboxamide (PubChem CID 92889475) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is (3S)-N-(3-ethoxypropyl)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-ethoxypropyl)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92889475 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3S)-N-(3-ethoxypropyl)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-3-carboxamide |
| SMILES | CCOCCCNC(=O)[C@H]1CCCN(c2ccc3nncn3n2)C1 |
| InChI | InChI=1S/C16H24N6O2/c1-2-24-10-4-8-17-16(23)13-5-3-9-21(11-13)15-7-6-14-19-18-12-22(14)20-15/h6-7,12-13H,2-5,8-11H2,1H3,(H,17,23)/t13-/m0/s1 |
| InChIKey | XFSQZRYLWJQJDJ-ZDUSSCGKSA-N |
| XLogP | 0.88 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|