C16H21F3N6O — CID 49431618
N-butyl-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide (PubChem CID 49431618) has the molecular formula C16H21F3N6O and a molecular weight of 370.38 g/mol. Its IUPAC name is N-butyl-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide.
| Compound Name | N-butyl-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49431618 |
| Molecular Formula | C16H21F3N6O |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-butyl-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(c2ccc3nnc(C(F)(F)F)n3n2)C1 |
| InChI | InChI=1S/C16H21F3N6O/c1-2-3-8-20-14(26)11-5-4-9-24(10-11)13-7-6-12-21-22-15(16(17,18)19)25(12)23-13/h6-7,11H,2-5,8-10H2,1H3,(H,20,26) |
| InChIKey | IZWBVSDIEMTXOC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|