C21H23F3N6O — CID 42653585
N-(3-phenylpropyl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide (PubChem CID 42653585) has the molecular formula C21H23F3N6O and a molecular weight of 432.45 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42653585 |
| Molecular Formula | C21H23F3N6O |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-(3-phenylpropyl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCCN(c2ccc3nnc(C(F)(F)F)n3n2)C1 |
| InChI | InChI=1S/C21H23F3N6O/c22-21(23,24)20-27-26-17-10-11-18(28-30(17)20)29-13-5-9-16(14-29)19(31)25-12-4-8-15-6-2-1-3-7-15/h1-3,6-7,10-11,16H,4-5,8-9,12-14H2,(H,25,31) |
| InChIKey | GQAFAPKBJIDAAD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|