C26H28N6O — CID 52898495
N-(3-phenylpropyl)-1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide (PubChem CID 52898495) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 52898495 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-(3-phenylpropyl)-1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCN(c2ccc3nnc(-c4ccccc4)n3n2)CC1 |
| InChI | InChI=1S/C26H28N6O/c33-26(27-17-7-10-20-8-3-1-4-9-20)22-15-18-31(19-16-22)24-14-13-23-28-29-25(32(23)30-24)21-11-5-2-6-12-21/h1-6,8-9,11-14,22H,7,10,15-19H2,(H,27,33) |
| InChIKey | NOQLHSAZQVIASP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|