C20H22N6O — CID 52897739
1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 52897739) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | 1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 52897739 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1CCN(c2ccc3nnc(-c4ccccc4)n3n2)CC1 |
| InChI | InChI=1S/C20H22N6O/c1-2-12-21-20(27)16-10-13-25(14-11-16)18-9-8-17-22-23-19(26(17)24-18)15-6-4-3-5-7-15/h2-9,16H,1,10-14H2,(H,21,27) |
| InChIKey | NKNLSMZBBKCWDH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|