C25H27ClN4O — CID 121071544
1-[6-(4-chlorophenyl)pyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 121071544) has the molecular formula C25H27ClN4O and a molecular weight of 434.97 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)pyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-[6-(4-chlorophenyl)pyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071544 |
| Molecular Formula | C25H27ClN4O |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-[6-(4-chlorophenyl)pyridazin-3-yl]-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCCN(c2ccc(-c3ccc(Cl)cc3)nn2)C1 |
| InChI | InChI=1S/C25H27ClN4O/c26-22-12-10-20(11-13-22)23-14-15-24(29-28-23)30-17-5-9-21(18-30)25(31)27-16-4-8-19-6-2-1-3-7-19/h1-3,6-7,10-15,21H,4-5,8-9,16-18H2,(H,27,31) |
| InChIKey | GWUGLWCRQXRTAA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|