C15H15N5O2 — CID 144719937
(3Z)-4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]-2-methylidenehexa-3,5-dienenitrile (PubChem CID 144719937) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is (3Z)-4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3Z)-4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 144719937 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3Z)-4-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)methyl]-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C(=C\C(=C)C#N)Cc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H15N5O2/c1-5-10(6-9(2)8-16)7-11-17-12-13(18-11)19(3)15(22)20(4)14(12)21/h5-6H,1-2,7H2,3-4H3,(H,17,18)/b10-6+ |
| InChIKey | XTHLNALMUOFRDA-UXBLZVDNSA-N |
| XLogP | 0.69 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|