C14H18N6O2 — CID 139980879
8-(3-but-2-ynylpiperazin-1-yl)-3-methyl-7H-purine-2,6-dione (PubChem CID 139980879) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 8-(3-but-2-ynylpiperazin-1-yl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(3-but-2-ynylpiperazin-1-yl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 139980879 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 8-(3-but-2-ynylpiperazin-1-yl)-3-methyl-7H-purine-2,6-dione |
| SMILES | CC#CCC1CN(c2nc3c([nH]2)c(=O)[nH]c(=O)n3C)CCN1 |
| InChI | InChI=1S/C14H18N6O2/c1-3-4-5-9-8-20(7-6-15-9)13-16-10-11(17-13)19(2)14(22)18-12(10)21/h9,15H,5-8H2,1-2H3,(H,16,17)(H,18,21,22) |
| InChIKey | YHFXPZZQSKZQHU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|