C10H11N3O2S — CID 12620074
2-morpholin-4-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 12620074) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-morpholin-4-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-morpholin-4-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 12620074 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-morpholin-4-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCOCC2)nc2sccc12 |
| InChI | InChI=1S/C10H11N3O2S/c14-8-7-1-6-16-9(7)12-10(11-8)13-2-4-15-5-3-13/h1,6H,2-5H2,(H,11,12,14) |
| InChIKey | ZLPNPIUPJIWOFL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |