C16H18N5O2+ — CID 135532004
7-benzyl-2-morpholin-4-yl-1,9-dihydropurin-7-ium-6-one (PubChem CID 135532004) has the molecular formula C16H18N5O2+ and a molecular weight of 312.35 g/mol. Its IUPAC name is 7-benzyl-2-morpholin-4-yl-1,9-dihydropurin-7-ium-6-one.
| Compound Name | 7-benzyl-2-morpholin-4-yl-1,9-dihydropurin-7-ium-6-one |
|---|---|
| PubChem CID | 135532004 |
| Molecular Formula | C16H18N5O2+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 7-benzyl-2-morpholin-4-yl-1,9-dihydropurin-7-ium-6-one |
| SMILES | O=c1[nH]c(N2CCOCC2)nc2[nH]c[n+](Cc3ccccc3)c12 |
| InChI | InChI=1S/C16H17N5O2/c22-15-13-14(18-16(19-15)20-6-8-23-9-7-20)17-11-21(13)10-12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H,18,19,22)/p+1 |
| InChIKey | KSWZZZJEQWDPIO-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|