About 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide
4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide (PubChem CID 110205704) has the molecular formula C6H10Br2N4O
and a molecular weight of 313.98 g/mol. Its IUPAC name is 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide.
Molecular Properties
| Compound Name | 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide |
| PubChem CID | 110205704 |
| Molecular Formula | C6H10Br2N4O |
| Molecular Weight | 313.98 g/mol |
| Exact Mass | 311.92 |
| IUPAC Name | 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide |
| SMILES | Br.Brc1nc(N2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C6H9BrN4O.BrH/c7-5-8-6(10-9-5)11-1-3-12-4-2-11;/h1-4H2,(H,8,9,10);1H |
| InChIKey | MUQRWQPQWQWRTM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.98 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide?
The IUPAC name of 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide (CID 110205704) is 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide.
What is the SMILES notation for 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide?
The canonical SMILES for 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide is Br.Brc1nc(N2CCOCC2)n[nH]1.
What is the InChIKey of 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide?
The InChIKey is MUQRWQPQWQWRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN4O.BrH/c7-5-8-6(10-9-5)11-1-3-12-4-2-11;/h1-4H2,(H,8,9,10);1H.
What are the key properties of 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide?
4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide has a molecular weight of 313.98 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-1H-1,2,4-triazol-3-yl)morpholine;hydrobromide is sourced from PubChem (CID 110205704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).