C12H14N2O2 — CID 68557365
3-morpholin-4-yl-4H-1,2-benzoxazine (PubChem CID 68557365) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-morpholin-4-yl-4H-1,2-benzoxazine.
| Compound Name | 3-morpholin-4-yl-4H-1,2-benzoxazine |
|---|---|
| PubChem CID | 68557365 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-morpholin-4-yl-4H-1,2-benzoxazine |
| SMILES | c1ccc2c(c1)CC(N1CCOCC1)=NO2 |
| InChI | InChI=1S/C12H14N2O2/c1-2-4-11-10(3-1)9-12(13-16-11)14-5-7-15-8-6-14/h1-4H,5-9H2 |
| InChIKey | BVNHECAXMZTWND-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |