About 3-morpholin-4-yl-4H-1,2-benzoxazine
3-morpholin-4-yl-4H-1,2-benzoxazine (PubChem CID 68557365) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-morpholin-4-yl-4H-1,2-benzoxazine.
Molecular Properties
| Compound Name | 3-morpholin-4-yl-4H-1,2-benzoxazine |
| PubChem CID | 68557365 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-morpholin-4-yl-4H-1,2-benzoxazine |
| SMILES | c1ccc2c(c1)CC(N1CCOCC1)=NO2 |
| InChI | InChI=1S/C12H14N2O2/c1-2-4-11-10(3-1)9-12(13-16-11)14-5-7-15-8-6-14/h1-4H,5-9H2 |
| InChIKey | BVNHECAXMZTWND-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-morpholin-4-yl-4H-1,2-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-yl-4H-1,2-benzoxazine?
The IUPAC name of 3-morpholin-4-yl-4H-1,2-benzoxazine (CID 68557365) is 3-morpholin-4-yl-4H-1,2-benzoxazine.
What is the SMILES notation for 3-morpholin-4-yl-4H-1,2-benzoxazine?
The canonical SMILES for 3-morpholin-4-yl-4H-1,2-benzoxazine is c1ccc2c(c1)CC(N1CCOCC1)=NO2.
What is the InChIKey of 3-morpholin-4-yl-4H-1,2-benzoxazine?
The InChIKey is BVNHECAXMZTWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-2-4-11-10(3-1)9-12(13-16-11)14-5-7-15-8-6-14/h1-4H,5-9H2.
What are the key properties of 3-morpholin-4-yl-4H-1,2-benzoxazine?
3-morpholin-4-yl-4H-1,2-benzoxazine has a molecular weight of 218.26 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-yl-4H-1,2-benzoxazine is sourced from PubChem (CID 68557365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).