C11H13N2O3P — CID 3074324
2-morpholin-4-yl-3H-1,3,2-benzoxazaphosphinin-4-one (PubChem CID 3074324) has the molecular formula C11H13N2O3P and a molecular weight of 252.21 g/mol. Its IUPAC name is 2-morpholin-4-yl-3H-1,3,2-benzoxazaphosphinin-4-one.
| Compound Name | 2-morpholin-4-yl-3H-1,3,2-benzoxazaphosphinin-4-one |
|---|---|
| PubChem CID | 3074324 |
| Molecular Formula | C11H13N2O3P |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-morpholin-4-yl-3H-1,3,2-benzoxazaphosphinin-4-one |
| SMILES | O=C1NP(N2CCOCC2)Oc2ccccc21 |
| InChI | InChI=1S/C11H13N2O3P/c14-11-9-3-1-2-4-10(9)16-17(12-11)13-5-7-15-8-6-13/h1-4H,5-8H2,(H,12,14) |
| InChIKey | LJAIGFGAUBBLPF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|