C18H13N3O3S — CID 7114844
4-morpholin-4-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione (PubChem CID 7114844) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 4-morpholin-4-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione.
| Compound Name | 4-morpholin-4-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione |
|---|---|
| PubChem CID | 7114844 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-morpholin-4-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(N1CCOCC1)c1nsnc21 |
| InChI | InChI=1S/C18H13N3O3S/c22-17-10-3-1-2-4-11(10)18(23)14-12(17)9-13(15-16(14)20-25-19-15)21-5-7-24-8-6-21/h1-4,9H,5-8H2 |
| InChIKey | HTMGTMPTISIEEQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|