C18H14N4O2S — CID 74223647
4-piperazin-1-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione (PubChem CID 74223647) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-piperazin-1-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione.
| Compound Name | 4-piperazin-1-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione |
|---|---|
| PubChem CID | 74223647 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-piperazin-1-ylnaphtho[3,2-e][2,1,3]benzothiadiazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(N1CCNCC1)c1nsnc21 |
| InChI | InChI=1S/C18H14N4O2S/c23-17-10-3-1-2-4-11(10)18(24)14-12(17)9-13(15-16(14)21-25-20-15)22-7-5-19-6-8-22/h1-4,9,19H,5-8H2 |
| InChIKey | JMEJMQTXEYTVJZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|