C10H4N2O2S — CID 5257611
benzo[f][2,1,3]benzothiadiazole-4,9-dione (PubChem CID 5257611) has the molecular formula C10H4N2O2S and a molecular weight of 216.22 g/mol. Its IUPAC name is benzo[f][2,1,3]benzothiadiazole-4,9-dione.
| Compound Name | benzo[f][2,1,3]benzothiadiazole-4,9-dione |
|---|---|
| PubChem CID | 5257611 |
| Molecular Formula | C10H4N2O2S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | benzo[f][2,1,3]benzothiadiazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2nsnc21 |
| InChI | InChI=1S/C10H4N2O2S/c13-9-5-3-1-2-4-6(5)10(14)8-7(9)11-15-12-8/h1-4H |
| InChIKey | PNLMDYWSUOZQGN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|