C9H16N2O — CID 130557563
4-(2,3,4,5-tetrahydropyridin-6-yl)morpholine (PubChem CID 130557563) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrahydropyridin-6-yl)morpholine.
| Compound Name | 4-(2,3,4,5-tetrahydropyridin-6-yl)morpholine |
|---|---|
| PubChem CID | 130557563 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4-(2,3,4,5-tetrahydropyridin-6-yl)morpholine |
| SMILES | C1CCC(N2CCOCC2)=NC1 |
| InChI | InChI=1S/C9H16N2O/c1-2-4-10-9(3-1)11-5-7-12-8-6-11/h1-8H2 |
| InChIKey | JQZLBZSIARESFU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |