C10H15NO2 — CID 90443893
3-morpholin-4-ylcyclohexa-1,3-dien-1-ol (PubChem CID 90443893) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-morpholin-4-ylcyclohexa-1,3-dien-1-ol.
| Compound Name | 3-morpholin-4-ylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 90443893 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-morpholin-4-ylcyclohexa-1,3-dien-1-ol |
| SMILES | OC1=CC(N2CCOCC2)=CCC1 |
| InChI | InChI=1S/C10H15NO2/c12-10-3-1-2-9(8-10)11-4-6-13-7-5-11/h2,8,12H,1,3-7H2 |
| InChIKey | LOQWOVSNKUJQHF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |