C10H16N2O2 — CID 115695442
N-cyclopent-3-en-1-ylmorpholine-4-carboxamide (PubChem CID 115695442) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N-cyclopent-3-en-1-ylmorpholine-4-carboxamide.
| Compound Name | N-cyclopent-3-en-1-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 115695442 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-cyclopent-3-en-1-ylmorpholine-4-carboxamide |
| SMILES | O=C(NC1CC=CC1)N1CCOCC1 |
| InChI | InChI=1S/C10H16N2O2/c13-10(11-9-3-1-2-4-9)12-5-7-14-8-6-12/h1-2,9H,3-8H2,(H,11,13) |
| InChIKey | NUQYGLAJCXBSEK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|