C13H24N2O2 — CID 115589164
N-(4-ethylcyclohexyl)morpholine-4-carboxamide (PubChem CID 115589164) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)morpholine-4-carboxamide.
| Compound Name | N-(4-ethylcyclohexyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 115589164 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-(4-ethylcyclohexyl)morpholine-4-carboxamide |
| SMILES | CCC1CCC(NC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C13H24N2O2/c1-2-11-3-5-12(6-4-11)14-13(16)15-7-9-17-10-8-15/h11-12H,2-10H2,1H3,(H,14,16) |
| InChIKey | LCMHDNYNUYVRQC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |