C11H16BrN — CID 173233336
1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 173233336) has the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. Its IUPAC name is 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine.
| Compound Name | 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 173233336 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | BrC1=CC(N2CCCCC2)=CCC1 |
| InChI | InChI=1S/C11H16BrN/c12-10-5-4-6-11(9-10)13-7-2-1-3-8-13/h6,9H,1-5,7-8H2 |
| InChIKey | MCYFIARLFHZGAN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |