About 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine
1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 173233336) has the molecular formula C11H16BrN
and a molecular weight of 242.16 g/mol. Its IUPAC name is 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 173233336 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | BrC1=CC(N2CCCCC2)=CCC1 |
| InChI | InChI=1S/C11H16BrN/c12-10-5-4-6-11(9-10)13-7-2-1-3-8-13/h6,9H,1-5,7-8H2 |
| InChIKey | MCYFIARLFHZGAN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine (CID 173233336) is 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine is BrC1=CC(N2CCCCC2)=CCC1.
What is the InChIKey of 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is MCYFIARLFHZGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrN/c12-10-5-4-6-11(9-10)13-7-2-1-3-8-13/h6,9H,1-5,7-8H2.
What are the key properties of 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine?
1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 242.16 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromocyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 173233336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).