C9H15Hs3N — CID 175795723
hassium;2,3,4,6,7,8-hexahydro-1H-quinolizine (PubChem CID 175795723) has the molecular formula C9H15Hs3N and a molecular weight of 944.23 g/mol. Its IUPAC name is hassium;2,3,4,6,7,8-hexahydro-1H-quinolizine.
| Compound Name | hassium;2,3,4,6,7,8-hexahydro-1H-quinolizine |
|---|---|
| PubChem CID | 175795723 |
| Molecular Formula | C9H15Hs3N |
| Molecular Weight | 944.23 g/mol |
| Exact Mass | 944.52 |
| IUPAC Name | hassium;2,3,4,6,7,8-hexahydro-1H-quinolizine |
| SMILES | C1=C2CCCCN2CCC1.[Hs].[Hs].[Hs] |
| InChI | InChI=1S/C9H15N.3Hs/c1-3-7-10-8-4-2-6-9(10)5-1;;;/h5H,1-4,6-8H2;;; |
| InChIKey | AXEDQGMDYUSBHS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |