About 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene
6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene (PubChem CID 123488937) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene.
Molecular Properties
| Compound Name | 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene |
| PubChem CID | 123488937 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene |
| SMILES | CCCCCCCCC1=CCCCN2CCCCCC2=C1 |
| InChI | InChI=1S/C20H35N/c1-2-3-4-5-6-8-13-19-14-10-12-17-21-16-11-7-9-15-20(21)18-19/h14,18H,2-13,15-17H2,1H3 |
| InChIKey | MXGNUSOEOUEQRD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene?
The IUPAC name of 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene (CID 123488937) is 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene.
What is the SMILES notation for 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene?
The canonical SMILES for 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene is CCCCCCCCC1=CCCCN2CCCCCC2=C1.
What is the InChIKey of 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene?
The InChIKey is MXGNUSOEOUEQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-2-3-4-5-6-8-13-19-14-10-12-17-21-16-11-7-9-15-20(21)18-19/h14,18H,2-13,15-17H2,1H3.
What are the key properties of 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene?
6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene has a molecular weight of 289.51 g/mol, XLogP of 6.22, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-octyl-1-azabicyclo[6.5.0]trideca-5,7-diene is sourced from PubChem (CID 123488937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).