About 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one
1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one (PubChem CID 158819532) has the molecular formula C17H26F3NO
and a molecular weight of 317.40 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one |
| PubChem CID | 158819532 |
| Molecular Formula | C17H26F3NO |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one |
| SMILES | C1=C(N2CCCC2)CCCC1.O=C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C10H17N.C7H9F3O/c1-2-6-10(7-3-1)11-8-4-5-9-11;8-7(9,10)5-3-1-2-4-6(5)11/h6H,1-5,7-9H2;5H,1-4H2 |
| InChIKey | IVRQAMWAFILURE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one?
The IUPAC name of 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one (CID 158819532) is 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one.
What is the SMILES notation for 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one?
The canonical SMILES for 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one is C1=C(N2CCCC2)CCCC1.O=C1CCCCC1C(F)(F)F.
What is the InChIKey of 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one?
The InChIKey is IVRQAMWAFILURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.C7H9F3O/c1-2-6-10(7-3-1)11-8-4-5-9-11;8-7(9,10)5-3-1-2-4-6(5)11/h6H,1-5,7-9H2;5H,1-4H2.
What are the key properties of 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one?
1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one has a molecular weight of 317.40 g/mol, XLogP of 4.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexen-1-yl)pyrrolidine;2-(trifluoromethyl)cyclohexan-1-one is sourced from PubChem (CID 158819532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).