2,2-difluoro-2-(2-oxocyclohexyl)acetic acid

C8H10F2O3 — CID 84719815

IUPAC2,2-difluoro-2-(2-oxocyclohexyl)acetic acid
SMILESO=C1CCCCC1C(F)(F)C(=O)O
InChIInChI=1S/C8H10F2O3/c9-8(10,7(12)13)5-3-1-2-4-6(5)11/h5H,1-4H2,(H,12,13)
InChIKeyZZPDHNUNUGEYAK-UHFFFAOYSA-N
MW192.16 g/mol
LogP1.47
Rot. Bonds2

About 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid

2,2-difluoro-2-(2-oxocyclohexyl)acetic acid (PubChem CID 84719815) has the molecular formula C8H10F2O3 and a molecular weight of 192.16 g/mol. Its IUPAC name is 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid.

Molecular Properties

Compound Name2,2-difluoro-2-(2-oxocyclohexyl)acetic acid
PubChem CID84719815
Molecular FormulaC8H10F2O3
Molecular Weight192.16 g/mol
Exact Mass192.06
IUPAC Name2,2-difluoro-2-(2-oxocyclohexyl)acetic acid
SMILESO=C1CCCCC1C(F)(F)C(=O)O
InChIInChI=1S/C8H10F2O3/c9-8(10,7(12)13)5-3-1-2-4-6(5)11/h5H,1-4H2,(H,12,13)
InChIKeyZZPDHNUNUGEYAK-UHFFFAOYSA-N
XLogP1.47
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.16
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid?
The IUPAC name of 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid (CID 84719815) is 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid.
What is the SMILES notation for 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid?
The canonical SMILES for 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid is O=C1CCCCC1C(F)(F)C(=O)O.
What is the InChIKey of 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid?
The InChIKey is ZZPDHNUNUGEYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O3/c9-8(10,7(12)13)5-3-1-2-4-6(5)11/h5H,1-4H2,(H,12,13).
What are the key properties of 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid?
2,2-difluoro-2-(2-oxocyclohexyl)acetic acid has a molecular weight of 192.16 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-(2-oxocyclohexyl)acetic acid is sourced from PubChem (CID 84719815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).