C14H14F3NO2 — CID 67060770
N-(2-oxocyclohexyl)-4-(trifluoromethyl)benzamide (PubChem CID 67060770) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is N-(2-oxocyclohexyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2-oxocyclohexyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67060770 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(2-oxocyclohexyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCCCC1=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)10-7-5-9(6-8-10)13(20)18-11-3-1-2-4-12(11)19/h5-8,11H,1-4H2,(H,18,20) |
| InChIKey | CYMMPZNFPIPZKE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |